C20H23BrFN — CID 118857293
5-bromo-2-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)pyridine (PubChem CID 118857293) has the molecular formula C20H23BrFN and a molecular weight of 376.31 g/mol. Its IUPAC name is 5-bromo-2-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)pyridine.
| Compound Name | 5-bromo-2-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
|---|---|
| PubChem CID | 118857293 |
| Molecular Formula | C20H23BrFN |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 5-bromo-2-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
| SMILES | CC1(C)c2cc(-c3ccc(Br)cn3)cc(F)c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C20H23BrFN/c1-18(2)14-9-12(16-8-7-13(21)11-23-16)10-15(22)17(14)19(3,4)20(18,5)6/h7-11H,1-6H3 |
| InChIKey | PNIBIMHOILCPMS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |