C37H39FN6 — CID 118857297
6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 118857297) has the molecular formula C37H39FN6 and a molecular weight of 586.76 g/mol. Its IUPAC name is 6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 118857297 |
| Molecular Formula | C37H39FN6 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-2-N,4-N-dimethyl-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1ccccc1)c1nc(-c2cnc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)cc2F)nc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C37H39FN6/c1-35(2)28-20-19-24(21-29(28)36(3,4)37(35,5)6)31-22-30(38)27(23-39-31)32-40-33(43(7)25-15-11-9-12-16-25)42-34(41-32)44(8)26-17-13-10-14-18-26/h9-23H,1-8H3 |
| InChIKey | CQLSJNYIAYRNGB-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |