C28H26F2N4 — CID 118857301
2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenyl-1,3,5-triazine (PubChem CID 118857301) has the molecular formula C28H26F2N4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118857301 |
| Molecular Formula | C28H26F2N4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 2-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-3-pyridinyl]-4-methyl-6-phenyl-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2ccc(-c3ccc4c(c3)C(C)(C)C(F)(F)C4(C)C)nc2)n1 |
| InChI | InChI=1S/C28H26F2N4/c1-17-32-24(18-9-7-6-8-10-18)34-25(33-17)20-12-14-23(31-16-20)19-11-13-21-22(15-19)27(4,5)28(29,30)26(21,2)3/h6-16H,1-5H3 |
| InChIKey | QOOSQYABQONAGL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |