C7H14N2 — CID 118857303
2,4,6-trimethyl-1,2,3,4-tetrahydropyrimidine (PubChem CID 118857303) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,4,6-trimethyl-1,2,3,4-tetrahydropyrimidine.
| Compound Name | 2,4,6-trimethyl-1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 118857303 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2,4,6-trimethyl-1,2,3,4-tetrahydropyrimidine |
| SMILES | CC1=CC(C)NC(C)N1 |
| InChI | InChI=1S/C7H14N2/c1-5-4-6(2)9-7(3)8-5/h4-5,7-9H,1-3H3 |
| InChIKey | VCXHPJWCUAUHTM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |