C21H21F2N5 — CID 118857310
5-[5-(4,6-difluoro-1,3,5-triazin-2-yl)-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole (PubChem CID 118857310) has the molecular formula C21H21F2N5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-[5-(4,6-difluoro-1,3,5-triazin-2-yl)-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole.
| Compound Name | 5-[5-(4,6-difluoro-1,3,5-triazin-2-yl)-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole |
|---|---|
| PubChem CID | 118857310 |
| Molecular Formula | C21H21F2N5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 5-[5-(4,6-difluoro-1,3,5-triazin-2-yl)-2-pyridinyl]-1,1,2,3,3-pentamethylisoindole |
| SMILES | CN1C(C)(C)c2ccc(-c3ccc(-c4nc(F)nc(F)n4)cn3)cc2C1(C)C |
| InChI | InChI=1S/C21H21F2N5/c1-20(2)14-8-6-12(10-15(14)21(3,4)28(20)5)16-9-7-13(11-24-16)17-25-18(22)27-19(23)26-17/h6-11H,1-5H3 |
| InChIKey | NISYCXQYFXALOR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |