C41H43FN6 — CID 118857317
1-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-3,4-dihydro-2H-quinoline (PubChem CID 118857317) has the molecular formula C41H43FN6 and a molecular weight of 638.84 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 118857317 |
| Molecular Formula | C41H43FN6 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-[4-fluoro-6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-3,4-dihydro-2H-quinoline |
| SMILES | CC1(C)c2ccc(-c3cc(F)c(-c4nc(N5CCCc6ccccc65)nc(N5CCCc6ccccc65)n4)cn3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C41H43FN6/c1-39(2)30-20-19-28(23-31(30)40(3,4)41(39,5)6)33-24-32(42)29(25-43-33)36-44-37(47-21-11-15-26-13-7-9-17-34(26)47)46-38(45-36)48-22-12-16-27-14-8-10-18-35(27)48/h7-10,13-14,17-20,23-25H,11-12,15-16,21-22H2,1-6H3 |
| InChIKey | VTEODQSWZZAYGX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |