C41H45FN4 — CID 118857318
2,4-bis(4-tert-butylphenyl)-6-[4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 118857318) has the molecular formula C41H45FN4 and a molecular weight of 612.84 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118857318 |
| Molecular Formula | C41H45FN4 |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.36 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[4-fluoro-6-(1,1,3,3-tetramethyl-2H-inden-5-yl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3cnc(-c4ccc5c(c4)C(C)(C)CC5(C)C)cc3F)n2)cc1 |
| InChI | InChI=1S/C41H45FN4/c1-38(2,3)28-16-11-25(12-17-28)35-44-36(26-13-18-29(19-14-26)39(4,5)6)46-37(45-35)30-23-43-34(22-33(30)42)27-15-20-31-32(21-27)41(9,10)24-40(31,7)8/h11-23H,24H2,1-10H3 |
| InChIKey | KPMCGCMOWKRHSN-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |