C43H33F2N5 — CID 118857338
9-[4-[1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinolin-4-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 118857338) has the molecular formula C43H33F2N5 and a molecular weight of 657.77 g/mol. Its IUPAC name is 9-[4-[1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinolin-4-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-[1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinolin-4-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 118857338 |
| Molecular Formula | C43H33F2N5 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | 9-[4-[1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinolin-4-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | CC1(C)c2ccc(-c3ncc(-c4nc(-c5ccccc5)nc(-n5c6ccccc6c6ccccc65)n4)c4ccccc34)cc2C(C)(C)C1(F)F |
| InChI | InChI=1S/C43H33F2N5/c1-41(2)33-23-22-27(24-34(33)42(3,4)43(41,44)45)37-31-19-9-8-16-28(31)32(25-46-37)39-47-38(26-14-6-5-7-15-26)48-40(49-39)50-35-20-12-10-17-29(35)30-18-11-13-21-36(30)50/h5-25H,1-4H3 |
| InChIKey | FJQSQRFNIQVWCA-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |