C37H28FN5 — CID 118857387
4-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-N,N,6-triphenyl-1,3,5-triazin-2-amine (PubChem CID 118857387) has the molecular formula C37H28FN5 and a molecular weight of 561.66 g/mol. Its IUPAC name is 4-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-N,N,6-triphenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-N,N,6-triphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118857387 |
| Molecular Formula | C37H28FN5 |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 4-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-N,N,6-triphenyl-1,3,5-triazin-2-amine |
| SMILES | Fc1cc(-c2nc(-c3ccccc3)nc(N(c3ccccc3)c3ccccc3)n2)cnc1-c1ccc2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C37H28FN5/c38-33-22-28(23-39-34(33)27-18-19-31-25-16-17-26(20-25)32(31)21-27)36-40-35(24-10-4-1-5-11-24)41-37(42-36)43(29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-15,18-19,21-23,25-26H,16-17,20H2 |
| InChIKey | KTBUWFXBUVWBBV-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |