C50H41FN4 — CID 118857404
2,4-bis(9,9-dimethylfluoren-2-yl)-6-[5-(fluoromethyl)-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 118857404) has the molecular formula C50H41FN4 and a molecular weight of 716.90 g/mol. Its IUPAC name is 2,4-bis(9,9-dimethylfluoren-2-yl)-6-[5-(fluoromethyl)-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(9,9-dimethylfluoren-2-yl)-6-[5-(fluoromethyl)-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118857404 |
| Molecular Formula | C50H41FN4 |
| Molecular Weight | 716.90 g/mol |
| Exact Mass | 716.33 |
| IUPAC Name | 2,4-bis(9,9-dimethylfluoren-2-yl)-6-[5-(fluoromethyl)-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4cnc(-c5ccc6c(c5)C5CCC6C5)c(CF)c4)nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)n3)cc21 |
| InChI | InChI=1S/C50H41FN4/c1-49(2)41-11-7-5-9-36(41)38-19-16-31(24-43(38)49)46-53-47(32-17-20-39-37-10-6-8-12-42(37)50(3,4)44(39)25-32)55-48(54-46)34-22-33(26-51)45(52-27-34)30-15-18-35-28-13-14-29(21-28)40(35)23-30/h5-12,15-20,22-25,27-29H,13-14,21,26H2,1-4H3 |
| InChIKey | UAENRWVEBQFYSI-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.90 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |