C55H39FN4 — CID 118857411
2-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 118857411) has the molecular formula C55H39FN4 and a molecular weight of 774.94 g/mol. Its IUPAC name is 2-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118857411 |
| Molecular Formula | C55H39FN4 |
| Molecular Weight | 774.94 g/mol |
| Exact Mass | 774.32 |
| IUPAC Name | 2-[5-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-4,6-bis[3-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | Fc1cc(-c2nc(-c3cccc(-c4cccc(-c5ccccc5)c4)c3)nc(-c3cccc(-c4cccc(-c5ccccc5)c4)c3)n2)cnc1-c1ccc2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C55H39FN4/c56-51-33-48(34-57-52(51)45-25-26-49-43-23-24-44(31-43)50(49)32-45)55-59-53(46-21-9-19-41(29-46)39-17-7-15-37(27-39)35-11-3-1-4-12-35)58-54(60-55)47-22-10-20-42(30-47)40-18-8-16-38(28-40)36-13-5-2-6-14-36/h1-22,25-30,32-34,43-44H,23-24,31H2 |
| InChIKey | NGDPMZPIBAELQT-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.94 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |