C39H46F3N5 — CID 118857470
8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 118857470) has the molecular formula C39H46F3N5 and a molecular weight of 641.83 g/mol. Its IUPAC name is 8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 118857470 |
| Molecular Formula | C39H46F3N5 |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.37 |
| IUPAC Name | 8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | CC1(C)c2ccc(-c3ncc(-c4nc(C5CCCCC5)nc(C5CCCCC5)n4)c4nc(C(F)(F)F)ccc34)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C39H46F3N5/c1-36(2)28-19-17-25(21-29(28)37(3,4)38(36,5)6)31-26-18-20-30(39(40,41)42)44-32(26)27(22-43-31)35-46-33(23-13-9-7-10-14-23)45-34(47-35)24-15-11-8-12-16-24/h17-24H,7-16H2,1-6H3 |
| InChIKey | XVPNPSYZBZOUHO-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |