C12H18N4 — CID 118857531
6-cyclohexa-2,4-dien-1-yl-N,N,4-trimethyl-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 118857531) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-yl-N,N,4-trimethyl-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | 6-cyclohexa-2,4-dien-1-yl-N,N,4-trimethyl-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118857531 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-yl-N,N,4-trimethyl-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | CC1N=C(C2C=CC=CC2)NC(N(C)C)=N1 |
| InChI | InChI=1S/C12H18N4/c1-9-13-11(10-7-5-4-6-8-10)15-12(14-9)16(2)3/h4-7,9-10H,8H2,1-3H3,(H,13,14,15) |
| InChIKey | GQBNEUWOFNYMLX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |