C28H35N3O4 — CID 118857800
ethyl (3R,4R)-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]-4-(2,3,4,5-tetramethylphenyl)piperidine-3-carboxylate (PubChem CID 118857800) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is ethyl (3R,4R)-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]-4-(2,3,4,5-tetramethylphenyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R,4R)-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]-4-(2,3,4,5-tetramethylphenyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 118857800 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | ethyl (3R,4R)-1-[2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl]-4-(2,3,4,5-tetramethylphenyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CN(CCn2c(=O)[nH]c3ccccc3c2=O)CC[C@H]1c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C28H35N3O4/c1-6-35-27(33)24-16-30(12-11-21(24)23-15-17(2)18(3)19(4)20(23)5)13-14-31-26(32)22-9-7-8-10-25(22)29-28(31)34/h7-10,15,21,24H,6,11-14,16H2,1-5H3,(H,29,34)/t21-,24-/m0/s1 |
| InChIKey | YORUSLSKJMJZMG-URXFXBBRSA-N |
| XLogP | 3.59 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |