C21H32O3 — CID 118857879
(3S,4R,9R,12R)-3,9-dimethyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-en-10-one (PubChem CID 118857879) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (3S,4R,9R,12R)-3,9-dimethyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-en-10-one.
| Compound Name | (3S,4R,9R,12R)-3,9-dimethyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-en-10-one |
|---|---|
| PubChem CID | 118857879 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3S,4R,9R,12R)-3,9-dimethyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-en-10-one |
| SMILES | C[C@H]1C(=O)OC2O[C@@H](C)[C@@H]3CCC([C@@]4(C)CCCC(C)(C)C4)=C1[C@H]23 |
| InChI | InChI=1S/C21H32O3/c1-12-16-15(21(5)10-6-9-20(3,4)11-21)8-7-14-13(2)23-19(17(14)16)24-18(12)22/h12-14,17,19H,6-11H2,1-5H3/t12-,13+,14+,17-,19?,21+/m1/s1 |
| InChIKey | VSEDGGLEEGRSCL-VHTAGOONSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|