C33H56O3 — CID 11885806
[(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbutyl carbonate (PubChem CID 11885806) has the molecular formula C33H56O3 and a molecular weight of 500.81 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbutyl carbonate.
| Compound Name | [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbutyl carbonate |
|---|---|
| PubChem CID | 11885806 |
| Molecular Formula | C33H56O3 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-methylbutyl carbonate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3CC=C4C[C@@H](OC(=O)OCCC(C)C)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C33H56O3/c1-22(2)9-8-10-24(5)28-13-14-29-27-12-11-25-21-26(36-31(34)35-20-17-23(3)4)15-18-32(25,6)30(27)16-19-33(28,29)7/h11,22-24,26-30H,8-10,12-21H2,1-7H3/t24-,26+,27-,28-,29+,30-,32+,33-/m1/s1 |
| InChIKey | XXTAHAQGGBPUCT-FZZSDFAVSA-N |
| XLogP | 9.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|