C22H24N2O2 — CID 118858077
[(5E)-5-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]methanol (PubChem CID 118858077) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is [(5E)-5-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]methanol.
| Compound Name | [(5E)-5-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 118858077 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(5E)-5-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinylidene]-7,8-dihydro-6H-naphthalen-2-yl]methanol |
| SMILES | COc1ccc2c(c1)CCC/C2=N\N=C1/CCCc2cc(CO)ccc21 |
| InChI | InChI=1S/C22H24N2O2/c1-26-18-9-11-20-17(13-18)5-3-7-22(20)24-23-21-6-2-4-16-12-15(14-25)8-10-19(16)21/h8-13,25H,2-7,14H2,1H3/b23-21+,24-22+ |
| InChIKey | MGZDPSBIRJJLOJ-MBALSZOMSA-N |
| XLogP | 4.05 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|