About 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine
2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine (PubChem CID 118858571) has the molecular formula C21H16ClN5O2
and a molecular weight of 405.85 g/mol. Its IUPAC name is 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine |
| PubChem CID | 118858571 |
| Molecular Formula | C21H16ClN5O2 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine |
| SMILES | Nc1ccc2nc(NCc3ccc(Oc4nc5cc(Cl)ccc5o4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H16ClN5O2/c22-13-3-8-19-18(9-13)27-21(29-19)28-15-5-1-12(2-6-15)11-24-20-25-16-7-4-14(23)10-17(16)26-20/h1-10H,11,23H2,(H2,24,25,26) |
| InChIKey | UPOWZXQTSINOND-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine?
The IUPAC name of 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine (CID 118858571) is 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine.
What is the SMILES notation for 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine?
The canonical SMILES for 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine is Nc1ccc2nc(NCc3ccc(Oc4nc5cc(Cl)ccc5o4)cc3)[nH]c2c1.
What is the InChIKey of 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine?
The InChIKey is UPOWZXQTSINOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClN5O2/c22-13-3-8-19-18(9-13)27-21(29-19)28-15-5-1-12(2-6-15)11-24-20-25-16-7-4-14(23)10-17(16)26-20/h1-10H,11,23H2,(H2,24,25,26).
What are the key properties of 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine?
2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine has a molecular weight of 405.85 g/mol, XLogP of 5.34, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[[4-[(5-chloro-1,3-benzoxazol-2-yl)oxy]phenyl]methyl]-3H-benzimidazole-2,5-diamine is sourced from PubChem (CID 118858571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).