C14H17FN6O2 — CID 118859396
3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-5-(methoxymethyl)-3H-1,2,4-triazole (PubChem CID 118859396) has the molecular formula C14H17FN6O2 and a molecular weight of 320.33 g/mol. Its IUPAC name is 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-5-(methoxymethyl)-3H-1,2,4-triazole.
| Compound Name | 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-5-(methoxymethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 118859396 |
| Molecular Formula | C14H17FN6O2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-5-(methoxymethyl)-3H-1,2,4-triazole |
| SMILES | COCC1=NC(c2ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc2)N=N1 |
| InChI | InChI=1S/C14H17FN6O2/c1-22-8-12-17-14(20-19-12)10-5-3-9(4-6-10)13(23-2)11(7-15)18-21-16/h3-6,11,13-14H,7-8H2,1-2H3/t11-,13-,14?/m1/s1 |
| InChIKey | YEKKPUWPPVRBBY-AYBZEELNSA-N |
| XLogP | 3.53 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|