About 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole
5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole (PubChem CID 118859406) has the molecular formula C11H12FN7O
and a molecular weight of 277.26 g/mol. Its IUPAC name is 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole |
| PubChem CID | 118859406 |
| Molecular Formula | C11H12FN7O |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole |
| SMILES | CO[C@H](c1ccc(-c2nn[nH]n2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C11H12FN7O/c1-20-10(9(6-12)14-17-13)7-2-4-8(5-3-7)11-15-18-19-16-11/h2-5,9-10H,6H2,1H3,(H,15,16,18,19)/t9-,10-/m1/s1 |
| InChIKey | MSUYBPMTROFZEQ-NXEZZACHSA-N |
| XLogP | 2.20 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole?
The IUPAC name of 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole (CID 118859406) is 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole.
What is the SMILES notation for 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole?
The canonical SMILES for 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole is CO[C@H](c1ccc(-c2nn[nH]n2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole?
The InChIKey is MSUYBPMTROFZEQ-NXEZZACHSA-N. The full InChI is InChI=1S/C11H12FN7O/c1-20-10(9(6-12)14-17-13)7-2-4-8(5-3-7)11-15-18-19-16-11/h2-5,9-10H,6H2,1H3,(H,15,16,18,19)/t9-,10-/m1/s1.
What are the key properties of 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole?
5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole has a molecular weight of 277.26 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2H-tetrazole is sourced from PubChem (CID 118859406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).