C7H6N4O — CID 118860391
3-methyl-5H-pyrido[2,3-e][1,2,4]triazin-6-one (PubChem CID 118860391) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is 3-methyl-5H-pyrido[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-methyl-5H-pyrido[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 118860391 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3-methyl-5H-pyrido[2,3-e][1,2,4]triazin-6-one |
| SMILES | Cc1nnc2ccc(=O)[nH]c2n1 |
| InChI | InChI=1S/C7H6N4O/c1-4-8-7-5(11-10-4)2-3-6(12)9-7/h2-3H,1H3,(H,8,9,10,12) |
| InChIKey | JZLIDLCWXUDCPE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |