About (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine
(3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine (PubChem CID 118860393) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine.
Molecular Properties
| Compound Name | (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine |
| PubChem CID | 118860393 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine |
| SMILES | COc1cccc(Nc2ccc3c(c2)OC[C@H](N)C3)c1 |
| InChI | InChI=1S/C16H18N2O2/c1-19-15-4-2-3-13(8-15)18-14-6-5-11-7-12(17)10-20-16(11)9-14/h2-6,8-9,12,18H,7,10,17H2,1H3/t12-/m1/s1 |
| InChIKey | ZVPANFDUERACPH-GFCCVEGCSA-N |
| XLogP | 2.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine?
The IUPAC name of (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine (CID 118860393) is (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine.
What is the SMILES notation for (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine?
The canonical SMILES for (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine is COc1cccc(Nc2ccc3c(c2)OC[C@H](N)C3)c1.
What is the InChIKey of (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine?
The InChIKey is ZVPANFDUERACPH-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-19-15-4-2-3-13(8-15)18-14-6-5-11-7-12(17)10-20-16(11)9-14/h2-6,8-9,12,18H,7,10,17H2,1H3/t12-/m1/s1.
What are the key properties of (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine?
(3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine has a molecular weight of 270.33 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-7-N-(3-methoxyphenyl)-3,4-dihydro-2H-chromene-3,7-diamine is sourced from PubChem (CID 118860393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).