C13H20N4O3S — CID 11886044
1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-cyclopentylsulfanyltetrazole (PubChem CID 11886044) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-cyclopentylsulfanyltetrazole.
| Compound Name | 1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-cyclopentylsulfanyltetrazole |
|---|---|
| PubChem CID | 11886044 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-cyclopentylsulfanyltetrazole |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1SC1CCCC1 |
| InChI | InChI=1S/C13H20N4O3S/c1-18-10-7-20-11-9(6-19-12(10)11)17-13(14-15-16-17)21-8-4-2-3-5-8/h8-12H,2-7H2,1H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | ACMLUUNBPXQSEF-IRCOFANPSA-N |
| XLogP | 1.06 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |