C43H33F3N6O8S — CID 118860574
2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethylcarbamothioylamino]benzoic acid (PubChem CID 118860574) has the molecular formula C43H33F3N6O8S and a molecular weight of 850.83 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethylcarbamothioylamino]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethylcarbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 118860574 |
| Molecular Formula | C43H33F3N6O8S |
| Molecular Weight | 850.83 g/mol |
| Exact Mass | 850.20 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-5-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethylcarbamothioylamino]benzoic acid |
| SMILES | O=C(NCCOCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)c1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C43H33F3N6O8S/c44-43(45,46)60-30-9-4-26(5-10-30)51-38-22-35(49-23-50-38)24-2-1-3-25(18-24)40(55)47-14-16-58-17-15-48-42(61)52-27-6-11-31(34(19-27)41(56)57)39-32-12-7-28(53)20-36(32)59-37-21-29(54)8-13-33(37)39/h1-13,18-23,53H,14-17H2,(H,47,55)(H,56,57)(H2,48,52,61)(H,49,50,51) |
| InChIKey | MINYDOQNXHVICM-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 197.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.83 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|