About [1]benzofuro[2,3-b]pyridin-5-amine
[1]benzofuro[2,3-b]pyridin-5-amine (PubChem CID 118860660) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is [1]benzofuro[2,3-b]pyridin-5-amine.
Molecular Properties
| Compound Name | [1]benzofuro[2,3-b]pyridin-5-amine |
| PubChem CID | 118860660 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | [1]benzofuro[2,3-b]pyridin-5-amine |
| SMILES | Nc1cccc2oc3ncccc3c12 |
| InChI | InChI=1S/C11H8N2O/c12-8-4-1-5-9-10(8)7-3-2-6-13-11(7)14-9/h1-6H,12H2 |
| InChIKey | ZWPGNXHSSSBYDL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1]benzofuro[2,3-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[2,3-b]pyridin-5-amine?
The IUPAC name of [1]benzofuro[2,3-b]pyridin-5-amine (CID 118860660) is [1]benzofuro[2,3-b]pyridin-5-amine.
What is the SMILES notation for [1]benzofuro[2,3-b]pyridin-5-amine?
The canonical SMILES for [1]benzofuro[2,3-b]pyridin-5-amine is Nc1cccc2oc3ncccc3c12.
What is the InChIKey of [1]benzofuro[2,3-b]pyridin-5-amine?
The InChIKey is ZWPGNXHSSSBYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c12-8-4-1-5-9-10(8)7-3-2-6-13-11(7)14-9/h1-6H,12H2.
What are the key properties of [1]benzofuro[2,3-b]pyridin-5-amine?
[1]benzofuro[2,3-b]pyridin-5-amine has a molecular weight of 184.20 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[2,3-b]pyridin-5-amine is sourced from PubChem (CID 118860660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).