C19H26N5O4+ — CID 11886091
4-[[4-[1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]tetrazol-5-yl]phenyl]methyl]morpholin-4-ium (PubChem CID 11886091) has the molecular formula C19H26N5O4+ and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-[[4-[1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]tetrazol-5-yl]phenyl]methyl]morpholin-4-ium.
| Compound Name | 4-[[4-[1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]tetrazol-5-yl]phenyl]methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 11886091 |
| Molecular Formula | C19H26N5O4+ |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-[[4-[1-[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]tetrazol-5-yl]phenyl]methyl]morpholin-4-ium |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1-c1ccc(C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C19H25N5O4/c1-25-16-12-28-17-15(11-27-18(16)17)24-19(20-21-22-24)14-4-2-13(3-5-14)10-23-6-8-26-9-7-23/h2-5,15-18H,6-12H2,1H3/p+1/t15-,16+,17+,18+/m0/s1 |
| InChIKey | ULPSVYPBDZVTGN-BSDSXHPESA-O |
| XLogP | -0.89 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |