About [1]benzothiolo[2,3-c]pyridin-7-amine
[1]benzothiolo[2,3-c]pyridin-7-amine (PubChem CID 118861170) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is [1]benzothiolo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | [1]benzothiolo[2,3-c]pyridin-7-amine |
| PubChem CID | 118861170 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | [1]benzothiolo[2,3-c]pyridin-7-amine |
| SMILES | Nc1ccc2c(c1)sc1cnccc12 |
| InChI | InChI=1S/C11H8N2S/c12-7-1-2-8-9-3-4-13-6-11(9)14-10(8)5-7/h1-6H,12H2 |
| InChIKey | JVDGNKWURJTMRP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1]benzothiolo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzothiolo[2,3-c]pyridin-7-amine?
The IUPAC name of [1]benzothiolo[2,3-c]pyridin-7-amine (CID 118861170) is [1]benzothiolo[2,3-c]pyridin-7-amine.
What is the SMILES notation for [1]benzothiolo[2,3-c]pyridin-7-amine?
The canonical SMILES for [1]benzothiolo[2,3-c]pyridin-7-amine is Nc1ccc2c(c1)sc1cnccc12.
What is the InChIKey of [1]benzothiolo[2,3-c]pyridin-7-amine?
The InChIKey is JVDGNKWURJTMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c12-7-1-2-8-9-3-4-13-6-11(9)14-10(8)5-7/h1-6H,12H2.
What are the key properties of [1]benzothiolo[2,3-c]pyridin-7-amine?
[1]benzothiolo[2,3-c]pyridin-7-amine has a molecular weight of 200.27 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzothiolo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 118861170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).