C26H35NO2 — CID 118861238
(1S,2R,5S,7R,9S,12S,16S)-1,2,12,16-tetramethyl-15-pyridin-3-yl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-en-5-ol (PubChem CID 118861238) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is (1S,2R,5S,7R,9S,12S,16S)-1,2,12,16-tetramethyl-15-pyridin-3-yl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-en-5-ol.
| Compound Name | (1S,2R,5S,7R,9S,12S,16S)-1,2,12,16-tetramethyl-15-pyridin-3-yl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-en-5-ol |
|---|---|
| PubChem CID | 118861238 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (1S,2R,5S,7R,9S,12S,16S)-1,2,12,16-tetramethyl-15-pyridin-3-yl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-en-5-ol |
| SMILES | C[C@]12CC[C@H](O)C[C@@]13O[C@H]3CC1[C@]2(C)CC[C@]2(C)C(c3cccnc3)=CC[C@@]12C |
| InChI | InChI=1S/C26H35NO2/c1-22-11-12-24(3)20(14-21-26(29-21)15-18(28)7-10-25(24,26)4)23(22,2)9-8-19(22)17-6-5-13-27-16-17/h5-6,8,13,16,18,20-21,28H,7,9-12,14-15H2,1-4H3/t18-,20?,21-,22+,23-,24-,25+,26-/m0/s1 |
| InChIKey | ZHVKLRSAWPDMLG-OQSGDOMNSA-N |
| XLogP | 5.39 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|