C20H18N6O4S — CID 11886127
N-[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-cyanobenzenesulfonamide (PubChem CID 11886127) has the molecular formula C20H18N6O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-cyanobenzenesulfonamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 11886127 |
| Molecular Formula | C20H18N6O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-cyanobenzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C20H18N6O4S/c21-10-14-8-4-5-9-17(14)31(27,28)23-15-11-29-19-16(12-30-18(15)19)26-20(22-24-25-26)13-6-2-1-3-7-13/h1-9,15-16,18-19,23H,11-12H2/t15-,16-,18+,19+/m0/s1 |
| InChIKey | FYZHDUZPKMHSBN-RNIPGJKVSA-N |
| XLogP | 0.90 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |