About 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine
3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 118861407) has the molecular formula C11H6Cl2N4
and a molecular weight of 265.10 g/mol. Its IUPAC name is 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 118861407 |
| Molecular Formula | C11H6Cl2N4 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1ncc(Cl)c(-c2c[nH]c3ncccc23)n1 |
| InChI | InChI=1S/C11H6Cl2N4/c12-8-5-16-11(13)17-9(8)7-4-15-10-6(7)2-1-3-14-10/h1-5H,(H,14,15) |
| InChIKey | STWMVHZNUMMHCC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine (CID 118861407) is 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine is Clc1ncc(Cl)c(-c2c[nH]c3ncccc23)n1.
What is the InChIKey of 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is STWMVHZNUMMHCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2N4/c12-8-5-16-11(13)17-9(8)7-4-15-10-6(7)2-1-3-14-10/h1-5H,(H,14,15).
What are the key properties of 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine?
3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 265.10 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dichloropyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 118861407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).