C17H26F3N5O5 — CID 118861418
tert-butyl N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate (PubChem CID 118861418) has the molecular formula C17H26F3N5O5 and a molecular weight of 437.42 g/mol. Its IUPAC name is tert-butyl N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118861418 |
| Molecular Formula | C17H26F3N5O5 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | tert-butyl N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate |
| SMILES | CN(C)CCN(C)c1nc(OCC(F)(F)F)c(NC(=O)OC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26F3N5O5/c1-16(2,3)30-15(26)21-11-9-12(25(27)28)13(24(6)8-7-23(4)5)22-14(11)29-10-17(18,19)20/h9H,7-8,10H2,1-6H3,(H,21,26) |
| InChIKey | GKRCRCUECALWPT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|