C13H10Cl2O2S2 — CID 118861555
4-[(2,4-dichlorophenyl)sulfanylmethyl]benzenesulfinic acid (PubChem CID 118861555) has the molecular formula C13H10Cl2O2S2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)sulfanylmethyl]benzenesulfinic acid.
| Compound Name | 4-[(2,4-dichlorophenyl)sulfanylmethyl]benzenesulfinic acid |
|---|---|
| PubChem CID | 118861555 |
| Molecular Formula | C13H10Cl2O2S2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)sulfanylmethyl]benzenesulfinic acid |
| SMILES | O=S(O)c1ccc(CSc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H10Cl2O2S2/c14-10-3-6-13(12(15)7-10)18-8-9-1-4-11(5-2-9)19(16)17/h1-7H,8H2,(H,16,17) |
| InChIKey | OYCPCXREPJJNBI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|