C12H18N2O — CID 118861825
(6E)-6-[(2E)-3-amino-2-methylpenta-2,4-dienylidene]-4-methyl-2,5-dihydro-1H-pyridin-2-ol (PubChem CID 118861825) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (6E)-6-[(2E)-3-amino-2-methylpenta-2,4-dienylidene]-4-methyl-2,5-dihydro-1H-pyridin-2-ol.
| Compound Name | (6E)-6-[(2E)-3-amino-2-methylpenta-2,4-dienylidene]-4-methyl-2,5-dihydro-1H-pyridin-2-ol |
|---|---|
| PubChem CID | 118861825 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (6E)-6-[(2E)-3-amino-2-methylpenta-2,4-dienylidene]-4-methyl-2,5-dihydro-1H-pyridin-2-ol |
| SMILES | C=C/C(N)=C(C)\C=C1/CC(C)=CC(O)N1 |
| InChI | InChI=1S/C12H18N2O/c1-4-11(13)9(3)7-10-5-8(2)6-12(15)14-10/h4,6-7,12,14-15H,1,5,13H2,2-3H3/b10-7+,11-9+ |
| InChIKey | SJDYISNJXJIXTO-PPZOTWNKSA-N |
| XLogP | 1.55 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|