About 6-amino-1,8a-dihydroquinolin-2-ol
6-amino-1,8a-dihydroquinolin-2-ol (PubChem CID 118861842) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-amino-1,8a-dihydroquinolin-2-ol.
Molecular Properties
| Compound Name | 6-amino-1,8a-dihydroquinolin-2-ol |
| PubChem CID | 118861842 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 6-amino-1,8a-dihydroquinolin-2-ol |
| SMILES | NC1=CC2=CC=C(O)NC2C=C1 |
| InChI | InChI=1S/C9H10N2O/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5,8,11-12H,10H2 |
| InChIKey | LKSXLLBYRDWBAA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1,8a-dihydroquinolin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,8a-dihydroquinolin-2-ol?
The IUPAC name of 6-amino-1,8a-dihydroquinolin-2-ol (CID 118861842) is 6-amino-1,8a-dihydroquinolin-2-ol.
What is the SMILES notation for 6-amino-1,8a-dihydroquinolin-2-ol?
The canonical SMILES for 6-amino-1,8a-dihydroquinolin-2-ol is NC1=CC2=CC=C(O)NC2C=C1.
What is the InChIKey of 6-amino-1,8a-dihydroquinolin-2-ol?
The InChIKey is LKSXLLBYRDWBAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1-5,8,11-12H,10H2.
What are the key properties of 6-amino-1,8a-dihydroquinolin-2-ol?
6-amino-1,8a-dihydroquinolin-2-ol has a molecular weight of 162.19 g/mol, XLogP of 0.70, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,8a-dihydroquinolin-2-ol is sourced from PubChem (CID 118861842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).