About 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid
6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid (PubChem CID 118861857) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid |
| PubChem CID | 118861857 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid |
| SMILES | CC(C)(c1cccc(C(=O)O)n1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12N4O2/c1-11(2,10-12-6-13-15-10)8-5-3-4-7(14-8)9(16)17/h3-6H,1-2H3,(H,16,17)(H,12,13,15) |
| InChIKey | XSKWXEMVJZKYMD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid (CID 118861857) is 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid is CC(C)(c1cccc(C(=O)O)n1)c1ncn[nH]1.
What is the InChIKey of 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid?
The InChIKey is XSKWXEMVJZKYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-11(2,10-12-6-13-15-10)8-5-3-4-7(14-8)9(16)17/h3-6H,1-2H3,(H,16,17)(H,12,13,15).
What are the key properties of 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid?
6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(1H-1,2,4-triazol-5-yl)propan-2-yl]pyridine-2-carboxylic acid is sourced from PubChem (CID 118861857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).