C13H19F3O7S — CID 118861925
1,1,2-trifluoro-3-(1-formyloxy-2,2,3-trimethylcyclopentanecarbonyl)oxypropane-1-sulfonic acid (PubChem CID 118861925) has the molecular formula C13H19F3O7S and a molecular weight of 376.35 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-(1-formyloxy-2,2,3-trimethylcyclopentanecarbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,2-trifluoro-3-(1-formyloxy-2,2,3-trimethylcyclopentanecarbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118861925 |
| Molecular Formula | C13H19F3O7S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1,1,2-trifluoro-3-(1-formyloxy-2,2,3-trimethylcyclopentanecarbonyl)oxypropane-1-sulfonic acid |
| SMILES | CC1CCC(OC=O)(C(=O)OCC(F)C(F)(F)S(=O)(=O)O)C1(C)C |
| InChI | InChI=1S/C13H19F3O7S/c1-8-4-5-12(23-7-17,11(8,2)3)10(18)22-6-9(14)13(15,16)24(19,20)21/h7-9H,4-6H2,1-3H3,(H,19,20,21) |
| InChIKey | JDDAZRCKSAVVAN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|