C12H14O4 — CID 118862590
(3S,3aR,6S,6aR)-3,6-bis(prop-2-ynoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 118862590) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-3,6-bis(prop-2-ynoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6S,6aR)-3,6-bis(prop-2-ynoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 118862590 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3S,3aR,6S,6aR)-3,6-bis(prop-2-ynoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C#CCO[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OCC#C |
| InChI | InChI=1S/C12H14O4/c1-3-5-13-9-7-15-12-10(14-6-4-2)8-16-11(9)12/h1-2,9-12H,5-8H2/t9-,10-,11+,12+/m0/s1 |
| InChIKey | HTWWBASHKVHAFG-NNYUYHANSA-N |
| XLogP | -0.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|