About ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate
ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate (PubChem CID 118863061) has the molecular formula C9H8IN3O2
and a molecular weight of 317.09 g/mol. Its IUPAC name is ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate |
| PubChem CID | 118863061 |
| Molecular Formula | C9H8IN3O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cccnn2c1I |
| InChI | InChI=1S/C9H8IN3O2/c1-2-15-9(14)7-8(10)13-6(12-7)4-3-5-11-13/h3-5H,2H2,1H3 |
| InChIKey | MPPQGDQFACBNCH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate?
The IUPAC name of ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate (CID 118863061) is ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate.
What is the SMILES notation for ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate?
The canonical SMILES for ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate is CCOC(=O)c1nc2cccnn2c1I.
What is the InChIKey of ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate?
The InChIKey is MPPQGDQFACBNCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8IN3O2/c1-2-15-9(14)7-8(10)13-6(12-7)4-3-5-11-13/h3-5H,2H2,1H3.
What are the key properties of ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate?
ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate has a molecular weight of 317.09 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-iodoimidazo[1,2-b]pyridazine-2-carboxylate is sourced from PubChem (CID 118863061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).