C19H29NO5 — CID 11886326
[(3aR,5aR,6R,7R,9aR,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-2-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] N-prop-2-enylcarbamate (PubChem CID 11886326) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is [(3aR,5aR,6R,7R,9aR,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-2-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] N-prop-2-enylcarbamate.
| Compound Name | [(3aR,5aR,6R,7R,9aR,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-2-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 11886326 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [(3aR,5aR,6R,7R,9aR,9bS)-6-(hydroxymethyl)-6,9a-dimethyl-2-oxo-3a,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-7-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)O[C@@H]1CC[C@]2(C)[C@@H](CC[C@H]3OC(=O)C[C@H]32)[C@]1(C)CO |
| InChI | InChI=1S/C19H29NO5/c1-4-9-20-17(23)25-15-7-8-18(2)12-10-16(22)24-13(12)5-6-14(18)19(15,3)11-21/h4,12-15,21H,1,5-11H2,2-3H3,(H,20,23)/t12-,13-,14-,15-,18+,19+/m1/s1 |
| InChIKey | BBVFGRRFXXASRT-CLJXZBEYSA-N |
| XLogP | 2.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|