C29H31F2N3O4S — CID 118863365
8-(2,4-difluorophenyl)-9-(6-hydroxyhexyl)-15-methyl-4-(methylsulfonylmethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one (PubChem CID 118863365) has the molecular formula C29H31F2N3O4S and a molecular weight of 555.65 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-9-(6-hydroxyhexyl)-15-methyl-4-(methylsulfonylmethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one.
| Compound Name | 8-(2,4-difluorophenyl)-9-(6-hydroxyhexyl)-15-methyl-4-(methylsulfonylmethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
|---|---|
| PubChem CID | 118863365 |
| Molecular Formula | C29H31F2N3O4S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 8-(2,4-difluorophenyl)-9-(6-hydroxyhexyl)-15-methyl-4-(methylsulfonylmethyl)-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaen-14-one |
| SMILES | Cn1cc2c3c(c[nH]c3c1=O)C(CCCCCCO)N(c1ccc(F)cc1F)c1ccc(CS(C)(=O)=O)cc1-2 |
| InChI | InChI=1S/C29H31F2N3O4S/c1-33-16-22-20-13-18(17-39(2,37)38)8-10-25(20)34(26-11-9-19(30)14-23(26)31)24(7-5-3-4-6-12-35)21-15-32-28(27(21)22)29(33)36/h8-11,13-16,24,32,35H,3-7,12,17H2,1-2H3 |
| InChIKey | VIRWCKMDOBDSQP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|