About 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate
3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate (PubChem CID 118863784) has the molecular formula C12H15N3O4
and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate.
Molecular Properties
| Compound Name | 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate |
| PubChem CID | 118863784 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate |
| SMILES | CC(=O)OCCCn1c(=O)c2[nH]ccc2n(C)c1=O |
| InChI | InChI=1S/C12H15N3O4/c1-8(16)19-7-3-6-15-11(17)10-9(4-5-13-10)14(2)12(15)18/h4-5,13H,3,6-7H2,1-2H3 |
| InChIKey | QYKCMUIISAWYPX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate?
The IUPAC name of 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate (CID 118863784) is 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate.
What is the SMILES notation for 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate?
The canonical SMILES for 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate is CC(=O)OCCCn1c(=O)c2[nH]ccc2n(C)c1=O.
What is the InChIKey of 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate?
The InChIKey is QYKCMUIISAWYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4/c1-8(16)19-7-3-6-15-11(17)10-9(4-5-13-10)14(2)12(15)18/h4-5,13H,3,6-7H2,1-2H3.
What are the key properties of 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate?
3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate has a molecular weight of 265.27 g/mol, XLogP of -0.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-2,4-dioxo-5H-pyrrolo[3,2-d]pyrimidin-3-yl)propyl acetate is sourced from PubChem (CID 118863784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).