About [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid
[1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid (PubChem CID 118864089) has the molecular formula C13H15ClN2O2S
and a molecular weight of 298.80 g/mol. Its IUPAC name is [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid.
Molecular Properties
| Compound Name | [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid |
| PubChem CID | 118864089 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid |
| SMILES | CC(C)CC(NC(=O)O)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-7(2)5-10(16-13(17)18)12-15-9-6-8(14)3-4-11(9)19-12/h3-4,6-7,10,16H,5H2,1-2H3,(H,17,18) |
| InChIKey | ZMJHSPOHMBHATA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid?
The IUPAC name of [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid (CID 118864089) is [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid.
What is the SMILES notation for [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid?
The canonical SMILES for [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid is CC(C)CC(NC(=O)O)c1nc2cc(Cl)ccc2s1.
What is the InChIKey of [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid?
The InChIKey is ZMJHSPOHMBHATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O2S/c1-7(2)5-10(16-13(17)18)12-15-9-6-8(14)3-4-11(9)19-12/h3-4,6-7,10,16H,5H2,1-2H3,(H,17,18).
What are the key properties of [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid?
[1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid has a molecular weight of 298.80 g/mol, XLogP of 4.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-chloro-1,3-benzothiazol-2-yl)-3-methylbutyl]carbamic acid is sourced from PubChem (CID 118864089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).