About 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole
4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 118864225) has the molecular formula C17H17ClF2N4O
and a molecular weight of 366.80 g/mol. Its IUPAC name is 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 118864225 |
| Molecular Formula | C17H17ClF2N4O |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CCn1cc(-c2ccc(Cl)c(OC(F)F)c2)cn1 |
| InChI | InChI=1S/C17H17ClF2N4O/c1-10-14(11(2)23-22-10)5-6-24-9-13(8-21-24)12-3-4-15(18)16(7-12)25-17(19)20/h3-4,7-9,17H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | CRTYJRKVIQBRIW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole (CID 118864225) is 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole is Cc1n[nH]c(C)c1CCn1cc(-c2ccc(Cl)c(OC(F)F)c2)cn1.
What is the InChIKey of 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole?
The InChIKey is CRTYJRKVIQBRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClF2N4O/c1-10-14(11(2)23-22-10)5-6-24-9-13(8-21-24)12-3-4-15(18)16(7-12)25-17(19)20/h3-4,7-9,17H,5-6H2,1-2H3,(H,22,23).
What are the key properties of 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole?
4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole has a molecular weight of 366.80 g/mol, XLogP of 4.39, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-[4-chloro-3-(difluoromethoxy)phenyl]pyrazol-1-yl]ethyl]-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 118864225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).