About butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole
butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole (PubChem CID 118864326) has the molecular formula C19H21FN4O5
and a molecular weight of 404.40 g/mol. Its IUPAC name is butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole.
Molecular Properties
| Compound Name | butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole |
| PubChem CID | 118864326 |
| Molecular Formula | C19H21FN4O5 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole |
| SMILES | COc1cc(F)ccc1-c1cnn(Cc2ccn(C)n2)c1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C15H15FN4O.C4H6O4/c1-19-6-5-13(18-19)10-20-9-11(8-17-20)14-4-3-12(16)7-15(14)21-2;5-3(6)1-2-4(7)8/h3-9H,10H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | OKZNVSXHRBNAOH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole?
The IUPAC name of butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole (CID 118864326) is butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole.
What is the SMILES notation for butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole?
The canonical SMILES for butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole is COc1cc(F)ccc1-c1cnn(Cc2ccn(C)n2)c1.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole?
The InChIKey is OKZNVSXHRBNAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN4O.C4H6O4/c1-19-6-5-13(18-19)10-20-9-11(8-17-20)14-4-3-12(16)7-15(14)21-2;5-3(6)1-2-4(7)8/h3-9H,10H2,1-2H3;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole?
butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole has a molecular weight of 404.40 g/mol, XLogP of 2.42, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;3-[[4-(4-fluoro-2-methoxyphenyl)pyrazol-1-yl]methyl]-1-methylpyrazole is sourced from PubChem (CID 118864326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).