About 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole
4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole (PubChem CID 118864329) has the molecular formula C17H17F3N4
and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole.
Molecular Properties
| Compound Name | 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole |
| PubChem CID | 118864329 |
| Molecular Formula | C17H17F3N4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole |
| SMILES | CCc1[nH]ncc1Cn1cc(-c2ccc(F)c(C(C)(F)F)c2)cn1 |
| InChI | InChI=1S/C17H17F3N4/c1-3-16-13(7-21-23-16)10-24-9-12(8-22-24)11-4-5-15(18)14(6-11)17(2,19)20/h4-9H,3,10H2,1-2H3,(H,21,23) |
| InChIKey | MVGNHQREGRFEQQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole?
The IUPAC name of 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole (CID 118864329) is 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole.
What is the SMILES notation for 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole?
The canonical SMILES for 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole is CCc1[nH]ncc1Cn1cc(-c2ccc(F)c(C(C)(F)F)c2)cn1.
What is the InChIKey of 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole?
The InChIKey is MVGNHQREGRFEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N4/c1-3-16-13(7-21-23-16)10-24-9-12(8-22-24)11-4-5-15(18)14(6-11)17(2,19)20/h4-9H,3,10H2,1-2H3,(H,21,23).
What are the key properties of 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole?
4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole has a molecular weight of 334.35 g/mol, XLogP of 4.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,1-difluoroethyl)-4-fluorophenyl]-1-[(5-ethyl-1H-pyrazol-4-yl)methyl]pyrazole is sourced from PubChem (CID 118864329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).