About 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole
5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole (PubChem CID 118864345) has the molecular formula C15H14F2N4
and a molecular weight of 288.30 g/mol. Its IUPAC name is 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole |
| PubChem CID | 118864345 |
| Molecular Formula | C15H14F2N4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole |
| SMILES | Cc1cc(Cn2cc(-c3cc(F)cc(F)c3)cn2)n(C)n1 |
| InChI | InChI=1S/C15H14F2N4/c1-10-3-15(20(2)19-10)9-21-8-12(7-18-21)11-4-13(16)6-14(17)5-11/h3-8H,9H2,1-2H3 |
| InChIKey | KYGBERMNMHOSMC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole?
The IUPAC name of 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole (CID 118864345) is 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole.
What is the SMILES notation for 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole?
The canonical SMILES for 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole is Cc1cc(Cn2cc(-c3cc(F)cc(F)c3)cn2)n(C)n1.
What is the InChIKey of 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole?
The InChIKey is KYGBERMNMHOSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N4/c1-10-3-15(20(2)19-10)9-21-8-12(7-18-21)11-4-13(16)6-14(17)5-11/h3-8H,9H2,1-2H3.
What are the key properties of 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole?
5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole has a molecular weight of 288.30 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(3,5-difluorophenyl)pyrazol-1-yl]methyl]-1,3-dimethylpyrazole is sourced from PubChem (CID 118864345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).