C18H22N4 — CID 118864462
4-methyl-2-(6-pyridin-4-yl-1H-benzimidazol-2-yl)pentan-1-amine (PubChem CID 118864462) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-methyl-2-(6-pyridin-4-yl-1H-benzimidazol-2-yl)pentan-1-amine.
| Compound Name | 4-methyl-2-(6-pyridin-4-yl-1H-benzimidazol-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 118864462 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4-methyl-2-(6-pyridin-4-yl-1H-benzimidazol-2-yl)pentan-1-amine |
| SMILES | CC(C)CC(CN)c1nc2ccc(-c3ccncc3)cc2[nH]1 |
| InChI | InChI=1S/C18H22N4/c1-12(2)9-15(11-19)18-21-16-4-3-14(10-17(16)22-18)13-5-7-20-8-6-13/h3-8,10,12,15H,9,11,19H2,1-2H3,(H,21,22) |
| InChIKey | LCLVMWOMDDHORY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |