C15H13BrFNO4 — CID 118864749
methyl 7-bromo-1-cyclopropyl-6-fluoro-8-methoxy-2-oxoquinoline-3-carboxylate (PubChem CID 118864749) has the molecular formula C15H13BrFNO4 and a molecular weight of 370.17 g/mol. Its IUPAC name is methyl 7-bromo-1-cyclopropyl-6-fluoro-8-methoxy-2-oxoquinoline-3-carboxylate.
| Compound Name | methyl 7-bromo-1-cyclopropyl-6-fluoro-8-methoxy-2-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118864749 |
| Molecular Formula | C15H13BrFNO4 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | methyl 7-bromo-1-cyclopropyl-6-fluoro-8-methoxy-2-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(F)c(Br)c(OC)c2n(C2CC2)c1=O |
| InChI | InChI=1S/C15H13BrFNO4/c1-21-13-11(16)10(17)6-7-5-9(15(20)22-2)14(19)18(12(7)13)8-3-4-8/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | AHAQJOKHCHULIJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |