C14H21ClN8 — CID 118864845
4-N,8-N-dimethyl-2-N,6-N-bis(prop-2-enyl)pyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride (PubChem CID 118864845) has the molecular formula C14H21ClN8 and a molecular weight of 336.83 g/mol. Its IUPAC name is 4-N,8-N-dimethyl-2-N,6-N-bis(prop-2-enyl)pyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride.
| Compound Name | 4-N,8-N-dimethyl-2-N,6-N-bis(prop-2-enyl)pyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride |
|---|---|
| PubChem CID | 118864845 |
| Molecular Formula | C14H21ClN8 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-N,8-N-dimethyl-2-N,6-N-bis(prop-2-enyl)pyrimido[5,4-d]pyrimidine-2,4,6,8-tetramine;hydrochloride |
| SMILES | C=CCNc1nc(NC)c2nc(NCC=C)nc(NC)c2n1.Cl |
| InChI | InChI=1S/C14H20N8.ClH/c1-5-7-17-13-19-9-10(11(15-3)21-13)20-14(18-8-6-2)22-12(9)16-4;/h5-6H,1-2,7-8H2,3-4H3,(H2,15,17,19,21)(H2,16,18,20,22);1H |
| InChIKey | PAJLNUBZPWXTAM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|