C17H30O6 — CID 118865721
(3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;undec-10-enoic acid (PubChem CID 118865721) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;undec-10-enoic acid.
| Compound Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;undec-10-enoic acid |
|---|---|
| PubChem CID | 118865721 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;undec-10-enoic acid |
| SMILES | C=CCCCCCCCCC(=O)O.O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C11H20O2.C6H10O4/c1-2-3-4-5-6-7-8-9-10-11(12)13;7-3-1-9-6-4(8)2-10-5(3)6/h2H,1,3-10H2,(H,12,13);3-8H,1-2H2/t;3-,4+,5-,6-/m.1/s1 |
| InChIKey | MTRGBJHZKVSIRC-VCDGYCQFSA-N |
| XLogP | 1.88 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|